2',3'-cGAMP

2',3'-cGAMP is an endogenous cGAMP in mammalian cells. It binds to STING with a high affinity and is a potent inducer of IFN-β.

2',3'-cGAMP, as the second messenger in the cGAS-STING signaling pathway, plays a crucial role in various pathological and physiological processes, including anti-infection, anti-tumor responses, autoimmune diseases, and inflammatory conditions. Consequently, the STING signaling pathway is a promising target for drug development. Additionally, the natural synthesis yield of 2',3'-cGAMP is low, and the phosphodiester bonds in its structure are susceptible to enzymatic degradation. Therefore, structural modifications of 2',3'-cGAMP to enhance stability contribute significantly to its pharmaceutical value.

1441190-66-4

2',3'-cGAMP is an endogenous cGAMP in mammalian cells. It binds to STING with a high affinity and is a potent inducer of IFN-β.

C20H24N10O13P2

2',3'-cGAMP can bind to STING, activating a cascade of downstream signaling events. The cGAS-STING signaling pathway serves as an intracellular surveillance system. When DNA from viruses or cancer cells enters the cytoplasm, cGAS (cyclic GMP-AMP synthase) is activated and catalyzes the synthesis of 2',3'-cGAMP from ATP and GTP. 2',3'-cGAMP acts as a warning signal, activating the STING (Stimulator of Interferon Genes) pathway. This ultimately induces the production of type I interferon (IFN-β) and other cytokines, initiating the immune response.

674.417

0.98

Anti-infective Research; Tumours; Inflammation; Immune Diseases

[H][C@@]12COP(O)(=O)O[C@@]3([H])[C@@H](O)[C@@]([H])(O[C@]3([H])COP(O)(=O)O[C@]([H])([C@@H]1O)[C@@]([H])(O2)n1cnc2c1[nH]c(N)nc2=O)n1cnc2c(N)ncnc12